C13H14N4O — CID 102057168
N,N-dimethyl-4-(pyridin-2-yldiazenyl)benzeneamine oxide (PubChem CID 102057168) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is N,N-dimethyl-4-(pyridin-2-yldiazenyl)benzeneamine oxide.
| Compound Name | N,N-dimethyl-4-(pyridin-2-yldiazenyl)benzeneamine oxide |
|---|---|
| PubChem CID | 102057168 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N,N-dimethyl-4-(pyridin-2-yldiazenyl)benzeneamine oxide |
| SMILES | C[N+](C)([O-])c1ccc(/N=N/c2ccccn2)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-17(2,18)12-8-6-11(7-9-12)15-16-13-5-3-4-10-14-13/h3-10H,1-2H3/b16-15+ |
| InChIKey | MAAZZDGTSFJAAF-FOCLMDBBSA-N |
| XLogP | 3.56 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|