C14H15ClN4O2S — CID 143874215
1-[2-[[4-[2-chloroethyl(methyl)amino]-2-hydroxyphenyl]diazenyl]-1,3-thiazol-5-yl]ethanone (PubChem CID 143874215) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is 1-[2-[[4-[2-chloroethyl(methyl)amino]-2-hydroxyphenyl]diazenyl]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-[[4-[2-chloroethyl(methyl)amino]-2-hydroxyphenyl]diazenyl]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 143874215 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[2-[[4-[2-chloroethyl(methyl)amino]-2-hydroxyphenyl]diazenyl]-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(/N=N/c2ccc(N(C)CCCl)cc2O)s1 |
| InChI | InChI=1S/C14H15ClN4O2S/c1-9(20)13-8-16-14(22-13)18-17-11-4-3-10(7-12(11)21)19(2)6-5-15/h3-4,7-8,21H,5-6H2,1-2H3/b18-17+ |
| InChIKey | OTEBRUKHBQMMFU-ISLYRVAYSA-N |
| XLogP | 4.14 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|