C16H23N5OS — CID 136648509
5-(dipropylamino)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)diazenyl]phenol (PubChem CID 136648509) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 5-(dipropylamino)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)diazenyl]phenol.
| Compound Name | 5-(dipropylamino)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)diazenyl]phenol |
|---|---|
| PubChem CID | 136648509 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(dipropylamino)-2-[(5-ethyl-1,3,4-thiadiazol-2-yl)diazenyl]phenol |
| SMILES | CCCN(CCC)c1ccc(/N=N/c2nnc(CC)s2)c(O)c1 |
| InChI | InChI=1S/C16H23N5OS/c1-4-9-21(10-5-2)12-7-8-13(14(22)11-12)17-19-16-20-18-15(6-3)23-16/h7-8,11,22H,4-6,9-10H2,1-3H3/b19-17+ |
| InChIKey | VVKBFMQIYUZEAY-HTXNQAPBSA-N |
| XLogP | 4.85 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|