C12H14N4OS2 — CID 143874335
5-[methyl(2-sulfanylethyl)amino]-2-(1,3-thiazol-2-yldiazenyl)phenol (PubChem CID 143874335) has the molecular formula C12H14N4OS2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 5-[methyl(2-sulfanylethyl)amino]-2-(1,3-thiazol-2-yldiazenyl)phenol.
| Compound Name | 5-[methyl(2-sulfanylethyl)amino]-2-(1,3-thiazol-2-yldiazenyl)phenol |
|---|---|
| PubChem CID | 143874335 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[methyl(2-sulfanylethyl)amino]-2-(1,3-thiazol-2-yldiazenyl)phenol |
| SMILES | CN(CCS)c1ccc(/N=N/c2nccs2)c(O)c1 |
| InChI | InChI=1S/C12H14N4OS2/c1-16(5-6-18)9-2-3-10(11(17)8-9)14-15-12-13-4-7-19-12/h2-4,7-8,17-18H,5-6H2,1H3/b15-14+ |
| InChIKey | SQMISVKCPRDCMX-CCEZHUSRSA-N |
| XLogP | 3.63 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|