C16H24IN5OS — CID 10161719
2-[N-(2-hydroxyethyl)-4-(1,3-thiazol-2-yldiazenyl)anilino]ethyl-trimethylazanium iodide (PubChem CID 10161719) has the molecular formula C16H24IN5OS and a molecular weight of 461.37 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-(1,3-thiazol-2-yldiazenyl)anilino]ethyl-trimethylazanium iodide.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-(1,3-thiazol-2-yldiazenyl)anilino]ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10161719 |
| Molecular Formula | C16H24IN5OS |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-(1,3-thiazol-2-yldiazenyl)anilino]ethyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCN(CCO)c1ccc(/N=N/c2nccs2)cc1.[I-] |
| InChI | InChI=1S/C16H24N5OS.HI/c1-21(2,3)11-9-20(10-12-22)15-6-4-14(5-7-15)18-19-16-17-8-13-23-16;/h4-8,13,22H,9-12H2,1-3H3;1H/q+1;/p-1/b19-18+; |
| InChIKey | RLSCEDYEAFVKEW-LTRPLHCISA-M |
| XLogP | 0.07 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|