C17H17N5O4S — CID 90768542
(2,5-dihydroxypyrrol-1-yl) 3-[N-methyl-4-(1,3-thiazol-2-yldiazenyl)anilino]propanoate (PubChem CID 90768542) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[N-methyl-4-(1,3-thiazol-2-yldiazenyl)anilino]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[N-methyl-4-(1,3-thiazol-2-yldiazenyl)anilino]propanoate |
|---|---|
| PubChem CID | 90768542 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[N-methyl-4-(1,3-thiazol-2-yldiazenyl)anilino]propanoate |
| SMILES | CN(CCC(=O)On1c(O)ccc1O)c1ccc(/N=N/c2nccs2)cc1 |
| InChI | InChI=1S/C17H17N5O4S/c1-21(10-8-16(25)26-22-14(23)6-7-15(22)24)13-4-2-12(3-5-13)19-20-17-18-9-11-27-17/h2-7,9,11,23-24H,8,10H2,1H3/b20-19+ |
| InChIKey | FGXDMRLAFSIDOI-FMQUCBEESA-N |
| XLogP | 3.25 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|