C18H18N4O4S — CID 91318505
(2,5-dihydroxypyrrol-1-yl) 2-[5-[[4-(dimethylamino)phenyl]diazenyl]thiophen-2-yl]acetate (PubChem CID 91318505) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[5-[[4-(dimethylamino)phenyl]diazenyl]thiophen-2-yl]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[5-[[4-(dimethylamino)phenyl]diazenyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 91318505 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[5-[[4-(dimethylamino)phenyl]diazenyl]thiophen-2-yl]acetate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(CC(=O)On3c(O)ccc3O)s2)cc1 |
| InChI | InChI=1S/C18H18N4O4S/c1-21(2)13-5-3-12(4-6-13)19-20-15-8-7-14(27-15)11-18(25)26-22-16(23)9-10-17(22)24/h3-10,23-24H,11H2,1-2H3/b20-19+ |
| InChIKey | CMVUAAAGTOXYME-FMQUCBEESA-N |
| XLogP | 3.64 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|