C14H15N3O3 — CID 136714423
4-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,2,3-triol (PubChem CID 136714423) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,2,3-triol.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 136714423 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzene-1,2,3-triol |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-17(2)10-5-3-9(4-6-10)15-16-11-7-8-12(18)14(20)13(11)19/h3-8,18-20H,1-2H3/b16-15+ |
| InChIKey | BVQVGYJGVMUWIM-FOCLMDBBSA-N |
| XLogP | 3.28 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|