C16H20N2O3 — CID 103953108
4-[[[4-(dimethylamino)phenyl]methylamino]methyl]benzene-1,2,3-triol (PubChem CID 103953108) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[[[4-(dimethylamino)phenyl]methylamino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[[4-(dimethylamino)phenyl]methylamino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103953108 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[[[4-(dimethylamino)phenyl]methylamino]methyl]benzene-1,2,3-triol |
| SMILES | CN(C)c1ccc(CNCc2ccc(O)c(O)c2O)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-18(2)13-6-3-11(4-7-13)9-17-10-12-5-8-14(19)16(21)15(12)20/h3-8,17,19-21H,9-10H2,1-2H3 |
| InChIKey | NJPXTVGUPSRUBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|