C12H17ClN2 — CID 115574896
4-[(2-chloroprop-2-enylamino)methyl]-N,N-dimethylaniline (PubChem CID 115574896) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 4-[(2-chloroprop-2-enylamino)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(2-chloroprop-2-enylamino)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115574896 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-[(2-chloroprop-2-enylamino)methyl]-N,N-dimethylaniline |
| SMILES | C=C(Cl)CNCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H17ClN2/c1-10(13)8-14-9-11-4-6-12(7-5-11)15(2)3/h4-7,14H,1,8-9H2,2-3H3 |
| InChIKey | WZCLYFQEDHGSFR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|