C17H18N4O3 — CID 39846636
2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]acetic acid (PubChem CID 39846636) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 39846636 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]acetic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-21(2)15-9-7-14(8-10-15)20-19-13-5-3-12(4-6-13)17(24)18-11-16(22)23/h3-10H,11H2,1-2H3,(H,18,24)(H,22,23)/b20-19+ |
| InChIKey | CJWMQZHWLJMCAQ-FMQUCBEESA-N |
| XLogP | 2.98 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|