C23H27N5O7S — CID 90736519
(2,5-dihydroxypyrrol-1-yl) 3-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethoxy]propanoate (PubChem CID 90736519) has the molecular formula C23H27N5O7S and a molecular weight of 517.56 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethoxy]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethoxy]propanoate |
|---|---|
| PubChem CID | 90736519 |
| Molecular Formula | C23H27N5O7S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]ethoxy]propanoate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NCCOCCC(=O)On3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C23H27N5O7S/c1-27(2)19-7-3-17(4-8-19)25-26-18-5-9-20(10-6-18)36(32,33)24-14-16-34-15-13-23(31)35-28-21(29)11-12-22(28)30/h3-12,24,29-30H,13-16H2,1-2H3/b26-25+ |
| InChIKey | XHKZAYZXINJCNI-OCEACIFDSA-N |
| XLogP | 2.72 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|