C24H36N4O4S — CID 143678928
4-[[4-(dimethylamino)phenyl]diazenyl]-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]benzenesulfonamide (PubChem CID 143678928) has the molecular formula C24H36N4O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]benzenesulfonamide.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143678928 |
| Molecular Formula | C24H36N4O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-[3-(3-hydroxy-3-methylbutoxy)-3-methylbutyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NCCC(C)(C)OCCC(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C24H36N4O4S/c1-23(2,29)16-18-32-24(3,4)15-17-25-33(30,31)22-13-9-20(10-14-22)27-26-19-7-11-21(12-8-19)28(5)6/h7-14,25,29H,15-18H2,1-6H3/b27-26+ |
| InChIKey | YZJNTSOZKOITIA-CYYJNZCTSA-N |
| XLogP | 4.79 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|