C26H36N6O8S — CID 25172541
N-[(2R,3R,4R,5R,6R)-2-[(E)-4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]butylideneamino]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 25172541) has the molecular formula C26H36N6O8S and a molecular weight of 592.68 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-2-[(E)-4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]butylideneamino]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-2-[(E)-4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]butylideneamino]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 25172541 |
| Molecular Formula | C26H36N6O8S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-2-[(E)-4-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]butylideneamino]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](O/N=C/CCCNS(=O)(=O)c2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H36N6O8S/c1-17(34)29-23-25(36)24(35)22(16-33)39-26(23)40-27-14-4-5-15-28-41(37,38)21-12-8-19(9-13-21)31-30-18-6-10-20(11-7-18)32(2)3/h6-14,22-26,28,33,35-36H,4-5,15-16H2,1-3H3,(H,29,34)/b27-14+,31-30+/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | YDYFDEIRELWDFE-GCGVVVIPSA-N |
| XLogP | 1.17 |
| TPSA | 194.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|