C22H31N7O5S — CID 138743755
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonamide (PubChem CID 138743755) has the molecular formula C22H31N7O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138743755 |
| Molecular Formula | C22H31N7O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NCCOCCOCCOCCN=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C22H31N7O5S/c1-29(2)21-7-3-19(4-8-21)26-27-20-5-9-22(10-6-20)35(30,31)25-12-14-33-16-18-34-17-15-32-13-11-24-28-23/h3-10,25H,11-18H2,1-2H3/b27-26+ |
| InChIKey | GFHJSEWRVGJEBR-CYYJNZCTSA-N |
| XLogP | 3.81 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|