C35H48N6O9S2 — CID 102051594
5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]-2-[3,6-bis(diethylamino)-9H-xanthen-9-yl]benzenesulfonic acid (PubChem CID 102051594) has the molecular formula C35H48N6O9S2 and a molecular weight of 760.94 g/mol. Its IUPAC name is 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]-2-[3,6-bis(diethylamino)-9H-xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]-2-[3,6-bis(diethylamino)-9H-xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102051594 |
| Molecular Formula | C35H48N6O9S2 |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.29 |
| IUPAC Name | 5-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylsulfamoyl]-2-[3,6-bis(diethylamino)-9H-xanthen-9-yl]benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C2c1ccc(S(=O)(=O)NCCOCCOCCOCCN=[N+]=[N-])cc1S(=O)(=O)O |
| InChI | InChI=1S/C35H48N6O9S2/c1-5-40(6-2)26-9-12-29-32(23-26)50-33-24-27(41(7-3)8-4)10-13-30(33)35(29)31-14-11-28(25-34(31)52(44,45)46)51(42,43)38-16-18-48-20-22-49-21-19-47-17-15-37-39-36/h9-14,23-25,35,38H,5-8,15-22H2,1-4H3,(H,44,45,46) |
| InChIKey | HVCKUCOEKASPHZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 192.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|