C24H31Cl2N5O5S — CID 89095472
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonamide (PubChem CID 89095472) has the molecular formula C24H31Cl2N5O5S and a molecular weight of 572.52 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonamide.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 89095472 |
| Molecular Formula | C24H31Cl2N5O5S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]benzenesulfonamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2[C@@H](c2cccc(S(=O)(=O)NCCOCCOCCOCCN=[N+]=[N-])c2)C1 |
| InChI | InChI=1S/C24H31Cl2N5O5S/c1-31-16-22(21-14-19(25)15-24(26)23(21)17-31)18-3-2-4-20(13-18)37(32,33)29-6-8-35-10-12-36-11-9-34-7-5-28-30-27/h2-4,13-15,22,29H,5-12,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | CFVAWZOLEXOSMW-JOCHJYFZSA-N |
| XLogP | 4.21 |
| TPSA | 125.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|