C25H32Cl2N6O4 — CID 86699381
1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]urea (PubChem CID 86699381) has the molecular formula C25H32Cl2N6O4 and a molecular weight of 551.48 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]urea.
| Compound Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 86699381 |
| Molecular Formula | C25H32Cl2N6O4 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-3-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]urea |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2cccc(NC(=O)NCCOCCOCCOCCN=[N+]=[N-])c2)C1 |
| InChI | InChI=1S/C25H32Cl2N6O4/c1-33-16-22(21-14-19(26)15-24(27)23(21)17-33)18-3-2-4-20(13-18)31-25(34)29-5-7-35-9-11-37-12-10-36-8-6-30-32-28/h2-4,13-15,22H,5-12,16-17H2,1H3,(H2,29,31,34) |
| InChIKey | WLSIFTFRHXOJFE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|