C22H28Cl2N4O — CID 22386875
1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 22386875) has the molecular formula C22H28Cl2N4O and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 22386875 |
| Molecular Formula | C22H28Cl2N4O |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1cccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C22H28Cl2N4O/c1-27(2)9-5-8-25-22(29)26-17-7-4-6-15(10-17)19-13-28(3)14-20-18(19)11-16(23)12-21(20)24/h4,6-7,10-12,19H,5,8-9,13-14H2,1-3H3,(H2,25,26,29) |
| InChIKey | CABPEGUVUDDIPO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|