C18H19Cl2N3OS — CID 87633613
1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-methylsulfanylurea (PubChem CID 87633613) has the molecular formula C18H19Cl2N3OS and a molecular weight of 396.34 g/mol. Its IUPAC name is 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-methylsulfanylurea.
| Compound Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-methylsulfanylurea |
|---|---|
| PubChem CID | 87633613 |
| Molecular Formula | C18H19Cl2N3OS |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-methylsulfanylurea |
| SMILES | CSNC(=O)Nc1cccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C18H19Cl2N3OS/c1-23-9-15(14-7-12(19)8-17(20)16(14)10-23)11-4-3-5-13(6-11)21-18(24)22-25-2/h3-8,15H,9-10H2,1-2H3,(H2,21,22,24) |
| InChIKey | USDVVXACIOXJRY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|