C26H35Cl2N3O4 — CID 70906028
1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]urea (PubChem CID 70906028) has the molecular formula C26H35Cl2N3O4 and a molecular weight of 524.49 g/mol. Its IUPAC name is 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]urea.
| Compound Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]urea |
|---|---|
| PubChem CID | 70906028 |
| Molecular Formula | C26H35Cl2N3O4 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 1-[3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-3-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]urea |
| SMILES | CCCOCCOCCOCCNC(=O)Nc1cccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C26H35Cl2N3O4/c1-3-8-33-10-12-35-13-11-34-9-7-29-26(32)30-21-6-4-5-19(14-21)23-17-31(2)18-24-22(23)15-20(27)16-25(24)28/h4-6,14-16,23H,3,7-13,17-18H2,1-2H3,(H2,29,30,32) |
| InChIKey | WCANAHCWCJDICA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|