C17H22N4O4S3 — CID 3266790
4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-methylsulfonylsulfanylethyl)benzenesulfonamide (PubChem CID 3266790) has the molecular formula C17H22N4O4S3 and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-methylsulfonylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-methylsulfonylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3266790 |
| Molecular Formula | C17H22N4O4S3 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(2-methylsulfonylsulfanylethyl)benzenesulfonamide |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NCCSS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H22N4O4S3/c1-21(2)16-8-4-14(5-9-16)19-20-15-6-10-17(11-7-15)28(24,25)18-12-13-26-27(3,22)23/h4-11,18H,12-13H2,1-3H3/b20-19+ |
| InChIKey | URGLPBPCBBYYPB-FMQUCBEESA-N |
| XLogP | 3.14 |
| TPSA | 108.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|