C20H27N5O4S — CID 101250685
(2S)-2-amino-6-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]hexanoic acid (PubChem CID 101250685) has the molecular formula C20H27N5O4S and a molecular weight of 433.53 g/mol. Its IUPAC name is (2S)-2-amino-6-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 101250685 |
| Molecular Formula | C20H27N5O4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2S)-2-amino-6-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]hexanoic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)NCCCC[C@H](N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H27N5O4S/c1-25(2)17-10-6-15(7-11-17)23-24-16-8-12-18(13-9-16)30(28,29)22-14-4-3-5-19(21)20(26)27/h6-13,19,22H,3-5,14,21H2,1-2H3,(H,26,27)/b24-23+/t19-/m0/s1 |
| InChIKey | GDDSFAAYQJAYQJ-SMIQVMJNSA-N |
| XLogP | 3.03 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|