C22H31FN4O4S — CID 87721429
6-[[4-(dimethylamino)phenyl]sulfonylamino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide (PubChem CID 87721429) has the molecular formula C22H31FN4O4S and a molecular weight of 466.58 g/mol. Its IUPAC name is 6-[[4-(dimethylamino)phenyl]sulfonylamino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide.
| Compound Name | 6-[[4-(dimethylamino)phenyl]sulfonylamino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87721429 |
| Molecular Formula | C22H31FN4O4S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 6-[[4-(dimethylamino)phenyl]sulfonylamino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
| SMILES | Cc1cc(NC(CCCCNS(=O)(=O)c2ccc(N(C)C)cc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C22H31FN4O4S/c1-15-13-17(14-16(2)21(15)23)25-20(22(28)26-29)7-5-6-12-24-32(30,31)19-10-8-18(9-11-19)27(3)4/h8-11,13-14,20,24-25,29H,5-7,12H2,1-4H3,(H,26,28) |
| InChIKey | ZEKYWCZDXALZRW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|