C14H21FN2O2 — CID 87721438
2-(3-fluoro-2,4-dimethylanilino)-N-hydroxyhexanamide (PubChem CID 87721438) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-(3-fluoro-2,4-dimethylanilino)-N-hydroxyhexanamide.
| Compound Name | 2-(3-fluoro-2,4-dimethylanilino)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87721438 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(3-fluoro-2,4-dimethylanilino)-N-hydroxyhexanamide |
| SMILES | CCCCC(Nc1ccc(C)c(F)c1C)C(=O)NO |
| InChI | InChI=1S/C14H21FN2O2/c1-4-5-6-12(14(18)17-19)16-11-8-7-9(2)13(15)10(11)3/h7-8,12,16,19H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | LRFFQXARPSOMDD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|