C15H24FNO3 — CID 143744124
2-[2-(4-fluorophenyl)ethyl]-N-hydroxyhexanamide;methanol (PubChem CID 143744124) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-N-hydroxyhexanamide;methanol.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-N-hydroxyhexanamide;methanol |
|---|---|
| PubChem CID | 143744124 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-N-hydroxyhexanamide;methanol |
| SMILES | CCCCC(CCc1ccc(F)cc1)C(=O)NO.CO |
| InChI | InChI=1S/C14H20FNO2.CH4O/c1-2-3-4-12(14(17)16-18)8-5-11-6-9-13(15)10-7-11;1-2/h6-7,9-10,12,18H,2-5,8H2,1H3,(H,16,17);2H,1H3 |
| InChIKey | LTMZONJVVSFGSJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|