C18H29FN2O3 — CID 87596608
(2S)-2-[2-[butyl(methyl)amino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide (PubChem CID 87596608) has the molecular formula C18H29FN2O3 and a molecular weight of 340.44 g/mol. Its IUPAC name is (2S)-2-[2-[butyl(methyl)amino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide.
| Compound Name | (2S)-2-[2-[butyl(methyl)amino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 87596608 |
| Molecular Formula | C18H29FN2O3 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2S)-2-[2-[butyl(methyl)amino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
| SMILES | CCCCN(C)CC[C@@H](CC(OC)c1ccc(F)cc1)C(=O)NO |
| InChI | InChI=1S/C18H29FN2O3/c1-4-5-11-21(2)12-10-15(18(22)20-23)13-17(24-3)14-6-8-16(19)9-7-14/h6-9,15,17,23H,4-5,10-13H2,1-3H3,(H,20,22)/t15-,17?/m0/s1 |
| InChIKey | ZHOANAKEBGPTED-MYJWUSKBSA-N |
| XLogP | 3.15 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|