C15H21FO4 — CID 139490254
(2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-hydroxyhexanoic acid (PubChem CID 139490254) has the molecular formula C15H21FO4 and a molecular weight of 284.33 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-hydroxyhexanoic acid.
| Compound Name | (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 139490254 |
| Molecular Formula | C15H21FO4 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-hydroxyhexanoic acid |
| SMILES | CO[C@H](C[C@H](CCCCO)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FO4/c1-20-14(11-5-7-13(16)8-6-11)10-12(15(18)19)4-2-3-9-17/h5-8,12,14,17H,2-4,9-10H2,1H3,(H,18,19)/t12-,14+/m0/s1 |
| InChIKey | XFUOOAKSMZIJEO-GXTWGEPZSA-N |
| XLogP | 2.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|