C22H25FO4 — CID 68841276
(E)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-phenylmethoxyhex-4-enoic acid (PubChem CID 68841276) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is (E)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-phenylmethoxyhex-4-enoic acid.
| Compound Name | (E)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-phenylmethoxyhex-4-enoic acid |
|---|---|
| PubChem CID | 68841276 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (E)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-6-phenylmethoxyhex-4-enoic acid |
| SMILES | CO[C@H](CC(C/C=C/COCc1ccccc1)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FO4/c1-26-21(18-10-12-20(23)13-11-18)15-19(22(24)25)9-5-6-14-27-16-17-7-3-2-4-8-17/h2-8,10-13,19,21H,9,14-16H2,1H3,(H,24,25)/b6-5+/t19?,21-/m1/s1 |
| InChIKey | DDFGTUZETOPIAX-TWQOZBAOSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|