C16H21FO3 — CID 59568886
(5S,7R)-5-acetyl-7-(4-fluorophenyl)-7-methoxyheptanal (PubChem CID 59568886) has the molecular formula C16H21FO3 and a molecular weight of 280.34 g/mol. Its IUPAC name is (5S,7R)-5-acetyl-7-(4-fluorophenyl)-7-methoxyheptanal.
| Compound Name | (5S,7R)-5-acetyl-7-(4-fluorophenyl)-7-methoxyheptanal |
|---|---|
| PubChem CID | 59568886 |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (5S,7R)-5-acetyl-7-(4-fluorophenyl)-7-methoxyheptanal |
| SMILES | CO[C@H](C[C@H](CCCC=O)C(C)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FO3/c1-12(19)14(5-3-4-10-18)11-16(20-2)13-6-8-15(17)9-7-13/h6-10,14,16H,3-5,11H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | KMDPQSGEWIYGET-GOEBONIOSA-N |
| XLogP | 3.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|