C15H19FO4 — CID 139495493
methyl (2S)-2-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-6-oxohexanoate (PubChem CID 139495493) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is methyl (2S)-2-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-6-oxohexanoate.
| Compound Name | methyl (2S)-2-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 139495493 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | methyl (2S)-2-[(2R)-2-(4-fluorophenyl)-2-hydroxyethyl]-6-oxohexanoate |
| SMILES | COC(=O)[C@@H](CCCC=O)C[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FO4/c1-20-15(19)12(4-2-3-9-17)10-14(18)11-5-7-13(16)8-6-11/h5-9,12,14,18H,2-4,10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | ARPBUSJWIKJLKO-GXTWGEPZSA-N |
| XLogP | 2.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|