C14H17FO4 — CID 87136249
methyl (4R)-4-(4-fluorophenyl)-4-methoxy-2-(2-oxoethyl)butanoate (PubChem CID 87136249) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is methyl (4R)-4-(4-fluorophenyl)-4-methoxy-2-(2-oxoethyl)butanoate.
| Compound Name | methyl (4R)-4-(4-fluorophenyl)-4-methoxy-2-(2-oxoethyl)butanoate |
|---|---|
| PubChem CID | 87136249 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl (4R)-4-(4-fluorophenyl)-4-methoxy-2-(2-oxoethyl)butanoate |
| SMILES | COC(=O)C(CC=O)C[C@@H](OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FO4/c1-18-13(10-3-5-12(15)6-4-10)9-11(7-8-16)14(17)19-2/h3-6,8,11,13H,7,9H2,1-2H3/t11?,13-/m1/s1 |
| InChIKey | SPBGEHSFQJZLQH-GLGOKHISSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|