C20H27FN2O3S — CID 87136092
(2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6-[methyl(thiophen-2-yl)amino]hexanamide (PubChem CID 87136092) has the molecular formula C20H27FN2O3S and a molecular weight of 394.51 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6-[methyl(thiophen-2-yl)amino]hexanamide.
| Compound Name | (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6-[methyl(thiophen-2-yl)amino]hexanamide |
|---|---|
| PubChem CID | 87136092 |
| Molecular Formula | C20H27FN2O3S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (2S)-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxy-6-[methyl(thiophen-2-yl)amino]hexanamide |
| SMILES | CO[C@H](C[C@H](CCCCN(C)c1cccs1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2O3S/c1-23(19-7-5-13-27-19)12-4-3-6-16(20(24)22-25)14-18(26-2)15-8-10-17(21)11-9-15/h5,7-11,13,16,18,25H,3-4,6,12,14H2,1-2H3,(H,22,24)/t16-,18+/m0/s1 |
| InChIKey | FZDAUVBQBGEYOB-FUHWJXTLSA-N |
| XLogP | 4.39 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|