About 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride
1-fluoro-4-propylbenzene;2-propylpentanoyl chloride (PubChem CID 142979821) has the molecular formula C17H26ClFO
and a molecular weight of 300.84 g/mol. Its IUPAC name is 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride.
Molecular Properties
| Compound Name | 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride |
| PubChem CID | 142979821 |
| Molecular Formula | C17H26ClFO |
| Molecular Weight | 300.84 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride |
| SMILES | CCCC(CCC)C(=O)Cl.CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C9H11F.C8H15ClO/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7(6-4-2)8(9)10/h4-7H,2-3H2,1H3;7H,3-6H2,1-2H3 |
| InChIKey | KHLHUYHXSXJHET-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.84 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The IUPAC name of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride (CID 142979821) is 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride.
What is the SMILES notation for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The canonical SMILES for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride is CCCC(CCC)C(=O)Cl.CCCc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The InChIKey is KHLHUYHXSXJHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F.C8H15ClO/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7(6-4-2)8(9)10/h4-7H,2-3H2,1H3;7H,3-6H2,1-2H3.
What are the key properties of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
1-fluoro-4-propylbenzene;2-propylpentanoyl chloride has a molecular weight of 300.84 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride is sourced from PubChem (CID 142979821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).