1-fluoro-4-propylbenzene;2-propylpentanoyl chloride

C17H26ClFO — CID 142979821

IUPAC1-fluoro-4-propylbenzene;2-propylpentanoyl chloride
SMILESCCCC(CCC)C(=O)Cl.CCCc1ccc(F)cc1
InChIInChI=1S/C9H11F.C8H15ClO/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7(6-4-2)8(9)10/h4-7H,2-3H2,1H3;7H,3-6H2,1-2H3
InChIKeyKHLHUYHXSXJHET-UHFFFAOYSA-N
MW300.84 g/mol
LogP5.75
Rot. Bonds7

About 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride

1-fluoro-4-propylbenzene;2-propylpentanoyl chloride (PubChem CID 142979821) has the molecular formula C17H26ClFO and a molecular weight of 300.84 g/mol. Its IUPAC name is 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride.

Molecular Properties

Compound Name1-fluoro-4-propylbenzene;2-propylpentanoyl chloride
PubChem CID142979821
Molecular FormulaC17H26ClFO
Molecular Weight300.84 g/mol
Exact Mass300.17
IUPAC Name1-fluoro-4-propylbenzene;2-propylpentanoyl chloride
SMILESCCCC(CCC)C(=O)Cl.CCCc1ccc(F)cc1
InChIInChI=1S/C9H11F.C8H15ClO/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7(6-4-2)8(9)10/h4-7H,2-3H2,1H3;7H,3-6H2,1-2H3
InChIKeyKHLHUYHXSXJHET-UHFFFAOYSA-N
XLogP5.75
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500300.84
LogP ≤ 55.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The IUPAC name of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride (CID 142979821) is 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride.
What is the SMILES notation for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The canonical SMILES for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride is CCCC(CCC)C(=O)Cl.CCCc1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
The InChIKey is KHLHUYHXSXJHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F.C8H15ClO/c1-2-3-8-4-6-9(10)7-5-8;1-3-5-7(6-4-2)8(9)10/h4-7H,2-3H2,1H3;7H,3-6H2,1-2H3.
What are the key properties of 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride?
1-fluoro-4-propylbenzene;2-propylpentanoyl chloride has a molecular weight of 300.84 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-propylbenzene;2-propylpentanoyl chloride is sourced from PubChem (CID 142979821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).