C22H28FN3O4 — CID 87720869
benzyl N-[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]carbamate (PubChem CID 87720869) has the molecular formula C22H28FN3O4 and a molecular weight of 417.48 g/mol. Its IUPAC name is benzyl N-[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 87720869 |
| Molecular Formula | C22H28FN3O4 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | benzyl N-[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]carbamate |
| SMILES | Cc1cc(NC(CCCCNC(=O)OCc2ccccc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C22H28FN3O4/c1-15-12-18(13-16(2)20(15)23)25-19(21(27)26-29)10-6-7-11-24-22(28)30-14-17-8-4-3-5-9-17/h3-5,8-9,12-13,19,25,29H,6-7,10-11,14H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | GGOIMVMJDBLBRK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|