C28H35FN4O3 — CID 87727892
6-[[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]acetyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide (PubChem CID 87727892) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is 6-[[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]acetyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide.
| Compound Name | 6-[[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]acetyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 87727892 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 6-[[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]acetyl]amino]-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxyhexanamide |
| SMILES | Cc1cc(NC(CCCCNC(=O)Cc2ccc(-n3c(C)ccc3C)cc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C28H35FN4O3/c1-18-15-23(16-19(2)27(18)29)31-25(28(35)32-36)7-5-6-14-30-26(34)17-22-10-12-24(13-11-22)33-20(3)8-9-21(33)4/h8-13,15-16,25,31,36H,5-7,14,17H2,1-4H3,(H,30,34)(H,32,35) |
| InChIKey | IDCPLVZCUKHIRH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|