C19H23N3O3 — CID 87749823
(2S)-2-amino-N-hydroxy-5-[[2-(4-phenylphenyl)acetyl]amino]pentanamide (PubChem CID 87749823) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2S)-2-amino-N-hydroxy-5-[[2-(4-phenylphenyl)acetyl]amino]pentanamide.
| Compound Name | (2S)-2-amino-N-hydroxy-5-[[2-(4-phenylphenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 87749823 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2S)-2-amino-N-hydroxy-5-[[2-(4-phenylphenyl)acetyl]amino]pentanamide |
| SMILES | N[C@@H](CCCNC(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H23N3O3/c20-17(19(24)22-25)7-4-12-21-18(23)13-14-8-10-16(11-9-14)15-5-2-1-3-6-15/h1-3,5-6,8-11,17,25H,4,7,12-13,20H2,(H,21,23)(H,22,24)/t17-/m0/s1 |
| InChIKey | FXJVZLUADPQWFB-KRWDZBQOSA-N |
| XLogP | 1.63 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|