C21H26FN3O6S — CID 87720879
3-[[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]sulfamoyl]benzoic acid (PubChem CID 87720879) has the molecular formula C21H26FN3O6S and a molecular weight of 467.52 g/mol. Its IUPAC name is 3-[[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 87720879 |
| Molecular Formula | C21H26FN3O6S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-[[5-(4-fluoro-3,5-dimethylanilino)-6-(hydroxyamino)-6-oxohexyl]sulfamoyl]benzoic acid |
| SMILES | Cc1cc(NC(CCCCNS(=O)(=O)c2cccc(C(=O)O)c2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C21H26FN3O6S/c1-13-10-16(11-14(2)19(13)22)24-18(20(26)25-29)8-3-4-9-23-32(30,31)17-7-5-6-15(12-17)21(27)28/h5-7,10-12,18,23-24,29H,3-4,8-9H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | DHYQMWXRNAFEBQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|