C17H22N2O8S — CID 58594562
3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxohexyl]sulfamoyl]benzoic acid (PubChem CID 58594562) has the molecular formula C17H22N2O8S and a molecular weight of 414.44 g/mol. Its IUPAC name is 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxohexyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxohexyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 58594562 |
| Molecular Formula | C17H22N2O8S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxohexyl]sulfamoyl]benzoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)CCCCCNS(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H22N2O8S/c20-11-13(10-16(22)23)19-15(21)7-2-1-3-8-18-28(26,27)14-6-4-5-12(9-14)17(24)25/h4-6,9,11,13,18H,1-3,7-8,10H2,(H,19,21)(H,22,23)(H,24,25)/t13-/m0/s1 |
| InChIKey | PEPHLKCDIFRIHP-ZDUSSCGKSA-N |
| XLogP | 0.38 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|