C23H26N2O8S — CID 23645130
3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-phenylhexyl]sulfamoyl]benzoic acid (PubChem CID 23645130) has the molecular formula C23H26N2O8S and a molecular weight of 490.53 g/mol. Its IUPAC name is 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-phenylhexyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-phenylhexyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 23645130 |
| Molecular Formula | C23H26N2O8S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 3-[[6-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-phenylhexyl]sulfamoyl]benzoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)C(CCCCNS(=O)(=O)c1cccc(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O8S/c26-15-18(14-21(27)28)25-22(29)20(16-7-2-1-3-8-16)11-4-5-12-24-34(32,33)19-10-6-9-17(13-19)23(30)31/h1-3,6-10,13,15,18,20,24H,4-5,11-12,14H2,(H,25,29)(H,27,28)(H,30,31)/t18-,20?/m0/s1 |
| InChIKey | MRQYYMNQYZJKNI-LROBGIAVSA-N |
| XLogP | 1.78 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|