C21H24N2O9S2 — CID 10255842
5-[[6-[[(2R)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-thiophen-2-ylhexyl]sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 10255842) has the molecular formula C21H24N2O9S2 and a molecular weight of 512.56 g/mol. Its IUPAC name is 5-[[6-[[(2R)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-thiophen-2-ylhexyl]sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[6-[[(2R)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-thiophen-2-ylhexyl]sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 10255842 |
| Molecular Formula | C21H24N2O9S2 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 5-[[6-[[(2R)-1-carboxy-3-oxopropan-2-yl]amino]-6-oxo-5-thiophen-2-ylhexyl]sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | O=C[C@@H](CC(=O)O)NC(=O)C(CCCCNS(=O)(=O)c1ccc(O)c(C(=O)O)c1)c1cccs1 |
| InChI | InChI=1S/C21H24N2O9S2/c24-12-13(10-19(26)27)23-20(28)15(18-5-3-9-33-18)4-1-2-8-22-34(31,32)14-6-7-17(25)16(11-14)21(29)30/h3,5-7,9,11-13,15,22,25H,1-2,4,8,10H2,(H,23,28)(H,26,27)(H,29,30)/t13-,15?/m1/s1 |
| InChIKey | QDFWBTHASASXBN-AFYYWNPRSA-N |
| XLogP | 1.54 |
| TPSA | 187.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|