C21H23Cl2N3O5S — CID 10051688
(3R)-3-[[6-[(4-amino-3,5-dichlorobenzoyl)amino]-2-thiophen-2-ylhexanoyl]amino]-4-oxobutanoic acid (PubChem CID 10051688) has the molecular formula C21H23Cl2N3O5S and a molecular weight of 500.40 g/mol. Its IUPAC name is (3R)-3-[[6-[(4-amino-3,5-dichlorobenzoyl)amino]-2-thiophen-2-ylhexanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3R)-3-[[6-[(4-amino-3,5-dichlorobenzoyl)amino]-2-thiophen-2-ylhexanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10051688 |
| Molecular Formula | C21H23Cl2N3O5S |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (3R)-3-[[6-[(4-amino-3,5-dichlorobenzoyl)amino]-2-thiophen-2-ylhexanoyl]amino]-4-oxobutanoic acid |
| SMILES | Nc1c(Cl)cc(C(=O)NCCCCC(C(=O)N[C@@H](C=O)CC(=O)O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O5S/c22-15-8-12(9-16(23)19(15)24)20(30)25-6-2-1-4-14(17-5-3-7-32-17)21(31)26-13(11-27)10-18(28)29/h3,5,7-9,11,13-14H,1-2,4,6,10,24H2,(H,25,30)(H,26,31)(H,28,29)/t13-,14?/m1/s1 |
| InChIKey | NWCDLELBYQSYCC-KWCCSABGSA-N |
| XLogP | 3.48 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|