C13H19Cl2N3O — CID 82833147
4-amino-3,5-dichloro-N-[4-(dimethylamino)butyl]benzamide (PubChem CID 82833147) has the molecular formula C13H19Cl2N3O and a molecular weight of 304.22 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[4-(dimethylamino)butyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[4-(dimethylamino)butyl]benzamide |
|---|---|
| PubChem CID | 82833147 |
| Molecular Formula | C13H19Cl2N3O |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[4-(dimethylamino)butyl]benzamide |
| SMILES | CN(C)CCCCNC(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2N3O/c1-18(2)6-4-3-5-17-13(19)9-7-10(14)12(16)11(15)8-9/h7-8H,3-6,16H2,1-2H3,(H,17,19) |
| InChIKey | ABTKGRSHSDFZTA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|