C19H21Cl2N3O3S — CID 142840862
4-amino-3,5-dichloro-N-[6-oxo-6-(2-oxoethylamino)-5-thiophen-2-ylhexyl]benzamide (PubChem CID 142840862) has the molecular formula C19H21Cl2N3O3S and a molecular weight of 442.37 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[6-oxo-6-(2-oxoethylamino)-5-thiophen-2-ylhexyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[6-oxo-6-(2-oxoethylamino)-5-thiophen-2-ylhexyl]benzamide |
|---|---|
| PubChem CID | 142840862 |
| Molecular Formula | C19H21Cl2N3O3S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[6-oxo-6-(2-oxoethylamino)-5-thiophen-2-ylhexyl]benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCCCCC(C(=O)NCC=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O3S/c20-14-10-12(11-15(21)17(14)22)18(26)23-6-2-1-4-13(16-5-3-9-28-16)19(27)24-7-8-25/h3,5,8-11,13H,1-2,4,6-7,22H2,(H,23,26)(H,24,27) |
| InChIKey | IDLKLCHAQXZUTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|