C24H26N4O7S2 — CID 135559049
(3S)-4-oxo-3-[[6-[[3-(5-oxo-4H-1,2,4-thiadiazol-3-yl)phenyl]sulfonylamino]-2-phenylhexanoyl]amino]butanoic acid (PubChem CID 135559049) has the molecular formula C24H26N4O7S2 and a molecular weight of 546.63 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[6-[[3-(5-oxo-4H-1,2,4-thiadiazol-3-yl)phenyl]sulfonylamino]-2-phenylhexanoyl]amino]butanoic acid.
| Compound Name | (3S)-4-oxo-3-[[6-[[3-(5-oxo-4H-1,2,4-thiadiazol-3-yl)phenyl]sulfonylamino]-2-phenylhexanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 135559049 |
| Molecular Formula | C24H26N4O7S2 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | (3S)-4-oxo-3-[[6-[[3-(5-oxo-4H-1,2,4-thiadiazol-3-yl)phenyl]sulfonylamino]-2-phenylhexanoyl]amino]butanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)C(CCCCNS(=O)(=O)c1cccc(-c2nsc(=O)[nH]2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O7S2/c29-15-18(14-21(30)31)26-23(32)20(16-7-2-1-3-8-16)11-4-5-12-25-37(34,35)19-10-6-9-17(13-19)22-27-24(33)36-28-22/h1-3,6-10,13,15,18,20,25H,4-5,11-12,14H2,(H,26,32)(H,30,31)(H,27,28,33)/t18-,20?/m0/s1 |
| InChIKey | NREMGSBJJHGTQY-LROBGIAVSA-N |
| XLogP | 1.89 |
| TPSA | 175.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|