C37H47N5O8S — CID 18635959
benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-formyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 18635959) has the molecular formula C37H47N5O8S and a molecular weight of 721.88 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-formyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-formyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 18635959 |
| Molecular Formula | C37H47N5O8S |
| Molecular Weight | 721.88 g/mol |
| Exact Mass | 721.31 |
| IUPAC Name | benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-formyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC[C@](N)(C=O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](C=O)CCCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H47N5O8S/c1-28-17-19-32(20-18-28)51(48,49)40-23-11-9-21-37(38,27-44)35(46)42-33(24-29-12-4-2-5-13-29)34(45)41-31(25-43)16-8-10-22-39-36(47)50-26-30-14-6-3-7-15-30/h2-7,12-15,17-20,25,27,31,33,40H,8-11,16,21-24,26,38H2,1H3,(H,39,47)(H,41,45)(H,42,46)/t31-,33-,37-/m0/s1 |
| InChIKey | PWMDCJDMLCFLHI-RKYZPUHBSA-N |
| XLogP | 2.85 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.88 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|