C40H41N3O7S2 — CID 73293367
benzyl N-[(2S)-1-[[(E,3S)-1-(benzenesulfonyl)-7-(naphthalen-1-ylsulfonylamino)hept-1-en-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 73293367) has the molecular formula C40H41N3O7S2 and a molecular weight of 739.92 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(E,3S)-1-(benzenesulfonyl)-7-(naphthalen-1-ylsulfonylamino)hept-1-en-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(E,3S)-1-(benzenesulfonyl)-7-(naphthalen-1-ylsulfonylamino)hept-1-en-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 73293367 |
| Molecular Formula | C40H41N3O7S2 |
| Molecular Weight | 739.92 g/mol |
| Exact Mass | 739.24 |
| IUPAC Name | benzyl N-[(2S)-1-[[(E,3S)-1-(benzenesulfonyl)-7-(naphthalen-1-ylsulfonylamino)hept-1-en-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)N[C@H](/C=C/S(=O)(=O)c1ccccc1)CCCCNS(=O)(=O)c1cccc2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C40H41N3O7S2/c44-39(37(29-31-15-4-1-5-16-31)43-40(45)50-30-32-17-6-2-7-18-32)42-34(26-28-51(46,47)35-22-8-3-9-23-35)21-12-13-27-41-52(48,49)38-25-14-20-33-19-10-11-24-36(33)38/h1-11,14-20,22-26,28,34,37,41H,12-13,21,27,29-30H2,(H,42,44)(H,43,45)/b28-26+/t34-,37-/m0/s1 |
| InChIKey | SSRGITLSUITMFB-JAISHVMPSA-N |
| XLogP | 6.30 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.92 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|