C43H53N5O9S2 — CID 18635969
benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-(4-methylphenyl)sulfonyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 18635969) has the molecular formula C43H53N5O9S2 and a molecular weight of 848.06 g/mol. Its IUPAC name is benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-(4-methylphenyl)sulfonyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-(4-methylphenyl)sulfonyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 18635969 |
| Molecular Formula | C43H53N5O9S2 |
| Molecular Weight | 848.06 g/mol |
| Exact Mass | 847.33 |
| IUPAC Name | benzyl N-[(5S)-5-[[(2S)-2-[[(2S)-2-amino-2-(4-methylphenyl)sulfonyl-6-[(4-methylphenyl)sulfonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC[C@@](N)(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](C=O)CCCCNC(=O)OCc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H53N5O9S2/c1-32-18-22-37(23-19-32)58(53,54)43(44,26-10-12-28-46-59(55,56)38-24-20-33(2)21-25-38)41(51)48-39(29-34-13-5-3-6-14-34)40(50)47-36(30-49)17-9-11-27-45-42(52)57-31-35-15-7-4-8-16-35/h3-8,13-16,18-25,30,36,39,46H,9-12,17,26-29,31,44H2,1-2H3,(H,45,52)(H,47,50)(H,48,51)/t36-,39-,43-/m0/s1 |
| InChIKey | IBRFOIMKXSRVFP-FOSUGTBTSA-N |
| XLogP | 4.39 |
| TPSA | 219.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.06 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|