C20H20N2O9S — CID 90814128
5-[[4-[2-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-2-oxoethyl]phenyl]methylsulfamoyl]-2-hydroxybenzoic acid (PubChem CID 90814128) has the molecular formula C20H20N2O9S and a molecular weight of 464.45 g/mol. Its IUPAC name is 5-[[4-[2-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-2-oxoethyl]phenyl]methylsulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[4-[2-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-2-oxoethyl]phenyl]methylsulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 90814128 |
| Molecular Formula | C20H20N2O9S |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 5-[[4-[2-[[(2S)-1-carboxy-3-oxopropan-2-yl]amino]-2-oxoethyl]phenyl]methylsulfamoyl]-2-hydroxybenzoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)Cc1ccc(CNS(=O)(=O)c2ccc(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H20N2O9S/c23-11-14(8-19(26)27)22-18(25)7-12-1-3-13(4-2-12)10-21-32(30,31)15-5-6-17(24)16(9-15)20(28)29/h1-6,9,11,14,21,24H,7-8,10H2,(H,22,25)(H,26,27)(H,28,29)/t14-/m0/s1 |
| InChIKey | VOJQXXCHNXLPSQ-AWEZNQCLSA-N |
| XLogP | 0.27 |
| TPSA | 187.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|