C18H21N4O5S+ — CID 91929601
[amino-[3-[[4-(3-carboxyanilino)-4-oxobutyl]sulfamoyl]phenyl]methylidene]azanium (PubChem CID 91929601) has the molecular formula C18H21N4O5S+ and a molecular weight of 405.46 g/mol. Its IUPAC name is [amino-[3-[[4-(3-carboxyanilino)-4-oxobutyl]sulfamoyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[4-(3-carboxyanilino)-4-oxobutyl]sulfamoyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 91929601 |
| Molecular Formula | C18H21N4O5S+ |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [amino-[3-[[4-(3-carboxyanilino)-4-oxobutyl]sulfamoyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1cccc(S(=O)(=O)NCCCC(=O)Nc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H20N4O5S/c19-17(20)12-4-2-7-15(11-12)28(26,27)21-9-3-8-16(23)22-14-6-1-5-13(10-14)18(24)25/h1-2,4-7,10-11,21H,3,8-9H2,(H3,19,20)(H,22,23)(H,24,25)/p+1 |
| InChIKey | QXXWXTMTDJIQAI-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|